C21H24F2N8O2S — CID 171652650
N-[(2S)-5-(5-amino-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-2-yl)pentan-2-yl]-5-(2-hydroxypropan-2-yl)-N-methyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 171652650) has the molecular formula C21H24F2N8O2S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[(2S)-5-(5-amino-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-2-yl)pentan-2-yl]-5-(2-hydroxypropan-2-yl)-N-methyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[(2S)-5-(5-amino-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-2-yl)pentan-2-yl]-5-(2-hydroxypropan-2-yl)-N-methyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 171652650 |
| Molecular Formula | C21H24F2N8O2S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[(2S)-5-(5-amino-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-2-yl)pentan-2-yl]-5-(2-hydroxypropan-2-yl)-N-methyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | C[C@@H](CCCc1nc2c3cc(F)cc(F)c3nc(N)n2n1)N(C)C(=O)c1nnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C21H24F2N8O2S/c1-10(30(4)18(32)17-27-28-19(34-17)21(2,3)33)6-5-7-14-25-16-12-8-11(22)9-13(23)15(12)26-20(24)31(16)29-14/h8-10,33H,5-7H2,1-4H3,(H2,24,26)/t10-/m0/s1 |
| InChIKey | HUFWWPLSOBVLJM-JTQLQIEISA-N |
| XLogP | 2.70 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |