C25H30F2N6O2 — CID 171652903
2-(1-amino-4-methylhexan-2-yl)-N-[(2,4-dimethoxyphenyl)methyl]-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-5-amine (PubChem CID 171652903) has the molecular formula C25H30F2N6O2 and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-(1-amino-4-methylhexan-2-yl)-N-[(2,4-dimethoxyphenyl)methyl]-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
| Compound Name | 2-(1-amino-4-methylhexan-2-yl)-N-[(2,4-dimethoxyphenyl)methyl]-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 171652903 |
| Molecular Formula | C25H30F2N6O2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-(1-amino-4-methylhexan-2-yl)-N-[(2,4-dimethoxyphenyl)methyl]-7,9-difluoro-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| SMILES | CCC(C)CC(CN)c1nc2c3cc(F)cc(F)c3nc(NCc3ccc(OC)cc3OC)n2n1 |
| InChI | InChI=1S/C25H30F2N6O2/c1-5-14(2)8-16(12-28)23-31-24-19-9-17(26)10-20(27)22(19)30-25(33(24)32-23)29-13-15-6-7-18(34-3)11-21(15)35-4/h6-7,9-11,14,16H,5,8,12-13,28H2,1-4H3,(H,29,30) |
| InChIKey | TUNWKBOBZUPBDH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |