C19H27FN6O — CID 171653111
acetylene;ethane;9-fluoro-8-methoxy-2-[4-(methylamino)butyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine (PubChem CID 171653111) has the molecular formula C19H27FN6O and a molecular weight of 374.46 g/mol. Its IUPAC name is acetylene;ethane;9-fluoro-8-methoxy-2-[4-(methylamino)butyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
| Compound Name | acetylene;ethane;9-fluoro-8-methoxy-2-[4-(methylamino)butyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 171653111 |
| Molecular Formula | C19H27FN6O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | acetylene;ethane;9-fluoro-8-methoxy-2-[4-(methylamino)butyl]-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| SMILES | C#C.CC.CNCCCCc1nc2c3cc(F)c(OC)cc3nc(N)n2n1 |
| InChI | InChI=1S/C15H19FN6O.C2H6.C2H2/c1-18-6-4-3-5-13-20-14-9-7-10(16)12(23-2)8-11(9)19-15(17)22(14)21-13;2*1-2/h7-8,18H,3-6H2,1-2H3,(H2,17,19);1-2H3;1-2H |
| InChIKey | YEDVQASRKIFGBQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|