About molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol
molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol (PubChem CID 171653208) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol.
Molecular Properties
| Compound Name | molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol |
| PubChem CID | 171653208 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol |
| SMILES | OCCNCCc1cccc(Oc2ccccn2)c1.[H][H] |
| InChI | InChI=1S/C15H18N2O2.H2/c18-11-10-16-9-7-13-4-3-5-14(12-13)19-15-6-1-2-8-17-15;/h1-6,8,12,16,18H,7,9-11H2;1H |
| InChIKey | FBTAETPIPPUQGK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol?
The IUPAC name of molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol (CID 171653208) is molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol.
What is the SMILES notation for molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol?
The canonical SMILES for molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol is OCCNCCc1cccc(Oc2ccccn2)c1.[H][H].
What is the InChIKey of molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol?
The InChIKey is FBTAETPIPPUQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2.H2/c18-11-10-16-9-7-13-4-3-5-14(12-13)19-15-6-1-2-8-17-15;/h1-6,8,12,16,18H,7,9-11H2;1H.
What are the key properties of molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol?
molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol has a molecular weight of 260.34 g/mol, XLogP of 2.24, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2-[2-(3-pyridin-2-yloxyphenyl)ethylamino]ethanol is sourced from PubChem (CID 171653208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).