C30H46N4O6 — CID 171653883
2-[2-[2-[[4-[[(2E)-2-[[(E)-1-aminobutylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid (PubChem CID 171653883) has the molecular formula C30H46N4O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is 2-[2-[2-[[4-[[(2E)-2-[[(E)-1-aminobutylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[4-[[(2E)-2-[[(E)-1-aminobutylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171653883 |
| Molecular Formula | C30H46N4O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | 2-[2-[2-[[4-[[(2E)-2-[[(E)-1-aminobutylideneamino]-(pentylamino)methylidene]-3-methylidenepyrrol-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid |
| SMILES | C=c1ccn(Cc2ccc(COCCOCCOCC(=O)O)cc2OC)/c1=C(/N=C(/N)CCC)NCCCCC |
| InChI | InChI=1S/C30H46N4O6/c1-5-7-8-13-32-30(33-27(31)9-6-2)29-23(3)12-14-34(29)20-25-11-10-24(19-26(25)37-4)21-39-17-15-38-16-18-40-22-28(35)36/h10-12,14,19,32H,3,5-9,13,15-18,20-22H2,1-2,4H3,(H2,31,33)(H,35,36)/b30-29+ |
| InChIKey | IHCVTOXAVJDZJP-QVIHXGFCSA-N |
| XLogP | 2.59 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|