C32H49N5O3 — CID 171653892
2-[[4-[[(3aZ,8E,10E)-8-amino-10-(pentylamino)-6,7-dihydro-5H-pyrrolo[2,3-c]azonin-1-yl]methyl]-3-methoxyphenyl]methoxy]-N,N-dipropylacetamide (PubChem CID 171653892) has the molecular formula C32H49N5O3 and a molecular weight of 551.78 g/mol. Its IUPAC name is 2-[[4-[[(3aZ,8E,10E)-8-amino-10-(pentylamino)-6,7-dihydro-5H-pyrrolo[2,3-c]azonin-1-yl]methyl]-3-methoxyphenyl]methoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[[4-[[(3aZ,8E,10E)-8-amino-10-(pentylamino)-6,7-dihydro-5H-pyrrolo[2,3-c]azonin-1-yl]methyl]-3-methoxyphenyl]methoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 171653892 |
| Molecular Formula | C32H49N5O3 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | 2-[[4-[[(3aZ,8E,10E)-8-amino-10-(pentylamino)-6,7-dihydro-5H-pyrrolo[2,3-c]azonin-1-yl]methyl]-3-methoxyphenyl]methoxy]-N,N-dipropylacetamide |
| SMILES | CCCCCNC1=c2/c(ccn2Cc2ccc(COCC(=O)N(CCC)CCC)cc2OC)=C\CCC/C(N)=N\1 |
| InChI | InChI=1S/C32H49N5O3/c1-5-8-11-17-34-32-31-26(12-9-10-13-29(33)35-32)16-20-37(31)22-27-15-14-25(21-28(27)39-4)23-40-24-30(38)36(18-6-2)19-7-3/h12,14-16,20-21,34H,5-11,13,17-19,22-24H2,1-4H3,(H2,33,35)/b26-12-,32-31+ |
| InChIKey | MGVWERGTZCZBMJ-YTTDMOBRSA-N |
| XLogP | 3.88 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|