C32H51N4O2WY- — CID 171653910
N'-[(E)-[1-[[4-[1-(2-methanidyl-2-methylpropoxy)-2-methylpropan-2-yl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]butanimidamide;tungsten;yttrium (PubChem CID 171653910) has the molecular formula C32H51N4O2WY- and a molecular weight of 796.53 g/mol. Its IUPAC name is N'-[(E)-[1-[[4-[1-(2-methanidyl-2-methylpropoxy)-2-methylpropan-2-yl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]butanimidamide;tungsten;yttrium.
| Compound Name | N'-[(E)-[1-[[4-[1-(2-methanidyl-2-methylpropoxy)-2-methylpropan-2-yl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]butanimidamide;tungsten;yttrium |
|---|---|
| PubChem CID | 171653910 |
| Molecular Formula | C32H51N4O2WY- |
| Molecular Weight | 796.53 g/mol |
| Exact Mass | 796.26 |
| IUPAC Name | N'-[(E)-[1-[[4-[1-(2-methanidyl-2-methylpropoxy)-2-methylpropan-2-yl]-2-methoxyphenyl]methyl]-3-methylidenepyrrol-2-ylidene]-(pentylamino)methyl]butanimidamide;tungsten;yttrium |
| SMILES | C=c1ccn(Cc2ccc(C(C)(C)COCC([CH2-])(C)C)cc2OC)/c1=C(/N=C(/N)CCC)NCCCCC.[W].[Y] |
| InChI | InChI=1S/C32H51N4O2.W.Y/c1-10-12-13-18-34-30(35-28(33)14-11-2)29-24(3)17-19-36(29)21-25-15-16-26(20-27(25)37-9)32(7,8)23-38-22-31(4,5)6;;/h15-17,19-20,34H,3-4,10-14,18,21-23H2,1-2,5-9H3,(H2,33,35);;/q-1;;/b30-29+;; |
| InChIKey | ATPXMPGTDHLZDA-NFOZGECASA-N |
| XLogP | 5.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|