C29H42N4O6 — CID 171653915
2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid (PubChem CID 171653915) has the molecular formula C29H42N4O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is 2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171653915 |
| Molecular Formula | C29H42N4O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 2-[2-[2-[[4-[[(3aZ,7E,9E)-7-amino-9-(pentylamino)-5,6-dihydropyrrolo[2,3-c]azocin-1-yl]methyl]-3-methoxyphenyl]methoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CCCCCNC1=c2/c(ccn2Cc2ccc(COCCOCCOCC(=O)O)cc2OC)=C\CC/C(N)=N\1 |
| InChI | InChI=1S/C29H42N4O6/c1-3-4-5-12-31-29-28-23(7-6-8-26(30)32-29)11-13-33(28)19-24-10-9-22(18-25(24)36-2)20-38-16-14-37-15-17-39-21-27(34)35/h7,9-11,13,18,31H,3-6,8,12,14-17,19-21H2,1-2H3,(H2,30,32)(H,34,35)/b23-7-,29-28+ |
| InChIKey | NNQKWAPFIJVBTE-SPEPBESJSA-N |
| XLogP | 1.96 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|