C25H31BN7O4 — CID 171654567
CID 171654567 (PubChem CID 171654567) has the molecular formula C25H31BN7O4 and a molecular weight of 504.38 g/mol.
| Compound Name | CID 171654567 |
|---|---|
| PubChem CID | 171654567 |
| Molecular Formula | C25H31BN7O4 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | — |
| SMILES | C[B]C(=O)Nc1cccc(NCCC(=O)Nc2cnn(CC(=O)N(C)CCOc3ccc(C)cc3)c2)n1 |
| InChI | InChI=1S/C25H31BN7O4/c1-18-7-9-20(10-8-18)37-14-13-32(3)24(35)17-33-16-19(15-28-33)29-23(34)11-12-27-21-5-4-6-22(30-21)31-25(36)26-2/h4-10,15-16H,11-14,17H2,1-3H3,(H,29,34)(H2,27,30,31,36) |
| InChIKey | GWQRMVFIQKKLOH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|