About 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane
3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane (PubChem CID 171654971) has the molecular formula C10H15ClN2
and a molecular weight of 198.70 g/mol. Its IUPAC name is 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane.
Molecular Properties
| Compound Name | 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane |
| PubChem CID | 171654971 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane |
| SMILES | CC.CC1=CC2C(Cl)=CNC2N=C1 |
| InChI | InChI=1S/C8H9ClN2.C2H6/c1-5-2-6-7(9)4-11-8(6)10-3-5;1-2/h2-4,6,8,11H,1H3;1-2H3 |
| InChIKey | MHQFVGNYNBUWEX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane?
The IUPAC name of 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane (CID 171654971) is 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane.
What is the SMILES notation for 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane?
The canonical SMILES for 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane is CC.CC1=CC2C(Cl)=CNC2N=C1.
What is the InChIKey of 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane?
The InChIKey is MHQFVGNYNBUWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2.C2H6/c1-5-2-6-7(9)4-11-8(6)10-3-5;1-2/h2-4,6,8,11H,1H3;1-2H3.
What are the key properties of 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane?
3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane has a molecular weight of 198.70 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-methyl-3a,7a-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane is sourced from PubChem (CID 171654971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).