C22H23F4N5O5S — CID 171655128
5-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3,6-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)imidazo[4,5-b]pyridine-2-carboxamide (PubChem CID 171655128) has the molecular formula C22H23F4N5O5S and a molecular weight of 545.52 g/mol. Its IUPAC name is 5-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3,6-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)imidazo[4,5-b]pyridine-2-carboxamide.
| Compound Name | 5-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3,6-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)imidazo[4,5-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171655128 |
| Molecular Formula | C22H23F4N5O5S |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 5-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3,6-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)imidazo[4,5-b]pyridine-2-carboxamide |
| SMILES | Cc1cc2nc(C(=O)NC3(C)CCS(=O)(=O)CC3)n(C)c2nc1Oc1ncc(F)cc1OCC(F)(F)F |
| InChI | InChI=1S/C22H23F4N5O5S/c1-12-8-14-16(29-19(12)36-20-15(9-13(23)10-27-20)35-11-22(24,25)26)31(3)17(28-14)18(32)30-21(2)4-6-37(33,34)7-5-21/h8-10H,4-7,11H2,1-3H3,(H,30,32) |
| InChIKey | LPSVPMLOIOITCO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |