About 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine (PubChem CID 171655585) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine.
Molecular Properties
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine |
| PubChem CID | 171655585 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine |
| SMILES | CS1(CC2CC3C=CC2C3)CCCN1 |
| InChI | InChI=1S/C12H21NS/c1-14(6-2-5-13-14)9-12-8-10-3-4-11(12)7-10/h3-4,10-13H,2,5-9H2,1H3 |
| InChIKey | GQDFUOBHWNANQN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine?
The IUPAC name of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine (CID 171655585) is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine.
What is the SMILES notation for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine?
The canonical SMILES for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine is CS1(CC2CC3C=CC2C3)CCCN1.
What is the InChIKey of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine?
The InChIKey is GQDFUOBHWNANQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NS/c1-14(6-2-5-13-14)9-12-8-10-3-4-11(12)7-10/h3-4,10-13H,2,5-9H2,1H3.
What are the key properties of 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine?
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine has a molecular weight of 211.37 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-methyl-1,2-thiazolidine is sourced from PubChem (CID 171655585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).