About 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole
5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole (PubChem CID 171655869) has the molecular formula C14H15F3N4
and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole.
Molecular Properties
| Compound Name | 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole |
| PubChem CID | 171655869 |
| Molecular Formula | C14H15F3N4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole |
| SMILES | Cc1ccc(-c2nnn(C3CC(C(F)(F)F)C3)n2)cc1C |
| InChI | InChI=1S/C14H15F3N4/c1-8-3-4-10(5-9(8)2)13-18-20-21(19-13)12-6-11(7-12)14(15,16)17/h3-5,11-12H,6-7H2,1-2H3 |
| InChIKey | LGHTYLVEYODTGT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole?
The IUPAC name of 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole (CID 171655869) is 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole.
What is the SMILES notation for 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole?
The canonical SMILES for 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole is Cc1ccc(-c2nnn(C3CC(C(F)(F)F)C3)n2)cc1C.
What is the InChIKey of 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole?
The InChIKey is LGHTYLVEYODTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N4/c1-8-3-4-10(5-9(8)2)13-18-20-21(19-13)12-6-11(7-12)14(15,16)17/h3-5,11-12H,6-7H2,1-2H3.
What are the key properties of 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole?
5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole has a molecular weight of 296.30 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)-2-[3-(trifluoromethyl)cyclobutyl]tetrazole is sourced from PubChem (CID 171655869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).