C25H30F3N9O2 — CID 171656253
N-[5-[(Z)-N'-[amino-[2-(2,2,2-trifluoroethoxy)ethyl]amino]carbamimidoyl]-2-methylphenyl]-5-(1H-pyrazol-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;ethane (PubChem CID 171656253) has the molecular formula C25H30F3N9O2 and a molecular weight of 545.57 g/mol. Its IUPAC name is N-[5-[(Z)-N'-[amino-[2-(2,2,2-trifluoroethoxy)ethyl]amino]carbamimidoyl]-2-methylphenyl]-5-(1H-pyrazol-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;ethane.
| Compound Name | N-[5-[(Z)-N'-[amino-[2-(2,2,2-trifluoroethoxy)ethyl]amino]carbamimidoyl]-2-methylphenyl]-5-(1H-pyrazol-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 171656253 |
| Molecular Formula | C25H30F3N9O2 |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | N-[5-[(Z)-N'-[amino-[2-(2,2,2-trifluoroethoxy)ethyl]amino]carbamimidoyl]-2-methylphenyl]-5-(1H-pyrazol-4-yl)pyrazolo[1,5-a]pyridine-3-carboxamide;ethane |
| SMILES | CC.Cc1ccc(/C(N)=N/N(N)CCOCC(F)(F)F)cc1NC(=O)c1cnn2ccc(-c3cn[nH]c3)cc12 |
| InChI | InChI=1S/C23H24F3N9O2.C2H6/c1-14-2-3-16(21(27)33-35(28)6-7-37-13-23(24,25)26)8-19(14)32-22(36)18-12-31-34-5-4-15(9-20(18)34)17-10-29-30-11-17;1-2/h2-5,8-12H,6-7,13,28H2,1H3,(H2,27,33)(H,29,30)(H,32,36);1-2H3 |
| InChIKey | JUCUZSAEOLDZEI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 151.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|