C15H29BN4O3 — CID 171656390
2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole;propane-1,2-diimine (PubChem CID 171656390) has the molecular formula C15H29BN4O3 and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole;propane-1,2-diimine.
| Compound Name | 2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole;propane-1,2-diimine |
|---|---|
| PubChem CID | 171656390 |
| Molecular Formula | C15H29BN4O3 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole;propane-1,2-diimine |
| SMILES | COCCN1C=C(B2OC(C)(C)C(C)(C)O2)CN1.[H]/N=C/C(C)=N/[H] |
| InChI | InChI=1S/C12H23BN2O3.C3H6N2/c1-11(2)12(3,4)18-13(17-11)10-8-14-15(9-10)6-7-16-5;1-3(5)2-4/h9,14H,6-8H2,1-5H3;2,4-5H,1H3/b;4-2+,5-3+ |
| InChIKey | CLXDDHILBFIATB-CYHFEHQPSA-N |
| XLogP | 1.64 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|