About ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene
ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene (PubChem CID 171656800) has the molecular formula C20H40N2O
and a molecular weight of 324.55 g/mol. Its IUPAC name is ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene.
Molecular Properties
| Compound Name | ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene |
| PubChem CID | 171656800 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene |
| SMILES | C=CCCC.CC.CCC(C)CC(=O)N1C2CCC1CN(C)C2 |
| InChI | InChI=1S/C13H24N2O.C5H10.C2H6/c1-4-10(2)7-13(16)15-11-5-6-12(15)9-14(3)8-11;1-3-5-4-2;1-2/h10-12H,4-9H2,1-3H3;3H,1,4-5H2,2H3;1-2H3 |
| InChIKey | LZZBPABYLWFVKH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene?
The IUPAC name of ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene (CID 171656800) is ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene.
What is the SMILES notation for ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene?
The canonical SMILES for ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene is C=CCCC.CC.CCC(C)CC(=O)N1C2CCC1CN(C)C2.
What is the InChIKey of ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene?
The InChIKey is LZZBPABYLWFVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O.C5H10.C2H6/c1-4-10(2)7-13(16)15-11-5-6-12(15)9-14(3)8-11;1-3-5-4-2;1-2/h10-12H,4-9H2,1-3H3;3H,1,4-5H2,2H3;1-2H3.
What are the key properties of ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene?
ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene has a molecular weight of 324.55 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pentan-1-one;pent-1-ene is sourced from PubChem (CID 171656800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).