C29H35ClFN7O2Si — CID 171659868
[7-[[5-chloro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methanol (PubChem CID 171659868) has the molecular formula C29H35ClFN7O2Si and a molecular weight of 596.18 g/mol. Its IUPAC name is [7-[[5-chloro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methanol.
| Compound Name | [7-[[5-chloro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methanol |
|---|---|
| PubChem CID | 171659868 |
| Molecular Formula | C29H35ClFN7O2Si |
| Molecular Weight | 596.18 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | [7-[[5-chloro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-1-(2-trimethylsilylethoxymethyl)indazol-4-yl]methanol |
| SMILES | Cc1nc2c(F)cc(-c3nc(Nc4ccc(CO)c5cnn(COCC[Si](C)(C)C)c45)ncc3Cl)cc2n1C(C)C |
| InChI | InChI=1S/C29H35ClFN7O2Si/c1-17(2)38-18(3)34-27-23(31)11-20(12-25(27)38)26-22(30)14-32-29(36-26)35-24-8-7-19(15-39)21-13-33-37(28(21)24)16-40-9-10-41(4,5)6/h7-8,11-14,17,39H,9-10,15-16H2,1-6H3,(H,32,35,36) |
| InChIKey | RZJZZWKYHIZMKN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.18 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|