About 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol
5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol (PubChem CID 171660077) has the molecular formula C18H20ClN5O2
and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol.
Molecular Properties
| Compound Name | 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol |
| PubChem CID | 171660077 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol |
| SMILES | Nc1ncc(Cl)c(-c2cnn(-c3ccccc3)c2)n1.OC1CCCOC1 |
| InChI | InChI=1S/C13H10ClN5.C5H10O2/c14-11-7-16-13(15)18-12(11)9-6-17-19(8-9)10-4-2-1-3-5-10;6-5-2-1-3-7-4-5/h1-8H,(H2,15,16,18);5-6H,1-4H2 |
| InChIKey | WPNUSHLZOGFDTK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol?
The IUPAC name of 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol (CID 171660077) is 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol.
What is the SMILES notation for 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol?
The canonical SMILES for 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol is Nc1ncc(Cl)c(-c2cnn(-c3ccccc3)c2)n1.OC1CCCOC1.
What is the InChIKey of 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol?
The InChIKey is WPNUSHLZOGFDTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN5.C5H10O2/c14-11-7-16-13(15)18-12(11)9-6-17-19(8-9)10-4-2-1-3-5-10;6-5-2-1-3-7-4-5/h1-8H,(H2,15,16,18);5-6H,1-4H2.
What are the key properties of 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol?
5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol has a molecular weight of 373.84 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(1-phenylpyrazol-4-yl)pyrimidin-2-amine;oxan-3-ol is sourced from PubChem (CID 171660077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).