C23H36ClN5O3Si — CID 171660238
(3S,4R)-4-[[4-[4-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepin-3-yl]-5-chloropyrimidin-2-yl]amino]oxan-3-ol (PubChem CID 171660238) has the molecular formula C23H36ClN5O3Si and a molecular weight of 494.11 g/mol. Its IUPAC name is (3S,4R)-4-[[4-[4-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepin-3-yl]-5-chloropyrimidin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[4-[4-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepin-3-yl]-5-chloropyrimidin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 171660238 |
| Molecular Formula | C23H36ClN5O3Si |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (3S,4R)-4-[[4-[4-[tert-butyl(dimethyl)silyl]oxy-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepin-3-yl]-5-chloropyrimidin-2-yl]amino]oxan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCn2ncc(-c3nc(N[C@@H]4CCOC[C@H]4O)ncc3Cl)c21 |
| InChI | InChI=1S/C23H36ClN5O3Si/c1-23(2,3)33(4,5)32-19-8-6-7-10-29-21(19)15(12-26-29)20-16(24)13-25-22(28-20)27-17-9-11-31-14-18(17)30/h12-13,17-19,30H,6-11,14H2,1-5H3,(H,25,27,28)/t17-,18-,19?/m1/s1 |
| InChIKey | JQEPXPGAHQBAKK-PWCSWUJKSA-N |
| XLogP | 4.80 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|