C20H30ClN5O2 — CID 171660248
5-chloro-4-[1-[(4-methylcyclohexyl)methyl]pyrazol-4-yl]pyrimidin-2-amine;oxan-3-ol (PubChem CID 171660248) has the molecular formula C20H30ClN5O2 and a molecular weight of 407.95 g/mol. Its IUPAC name is 5-chloro-4-[1-[(4-methylcyclohexyl)methyl]pyrazol-4-yl]pyrimidin-2-amine;oxan-3-ol.
| Compound Name | 5-chloro-4-[1-[(4-methylcyclohexyl)methyl]pyrazol-4-yl]pyrimidin-2-amine;oxan-3-ol |
|---|---|
| PubChem CID | 171660248 |
| Molecular Formula | C20H30ClN5O2 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 5-chloro-4-[1-[(4-methylcyclohexyl)methyl]pyrazol-4-yl]pyrimidin-2-amine;oxan-3-ol |
| SMILES | CC1CCC(Cn2cc(-c3nc(N)ncc3Cl)cn2)CC1.OC1CCCOC1 |
| InChI | InChI=1S/C15H20ClN5.C5H10O2/c1-10-2-4-11(5-3-10)8-21-9-12(6-19-21)14-13(16)7-18-15(17)20-14;6-5-2-1-3-7-4-5/h6-7,9-11H,2-5,8H2,1H3,(H2,17,18,20);5-6H,1-4H2 |
| InChIKey | WWPXDGCKHUKMCD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |