About 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one
5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one (PubChem CID 171660626) has the molecular formula C15H13ClN4O
and a molecular weight of 300.75 g/mol. Its IUPAC name is 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one.
Molecular Properties
| Compound Name | 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one |
| PubChem CID | 171660626 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one |
| SMILES | Nc1ncc(Cl)c(-c2ccc3c(c2)C2(CCC2)NC3=O)n1 |
| InChI | InChI=1S/C15H13ClN4O/c16-11-7-18-14(17)19-12(11)8-2-3-9-10(6-8)15(4-1-5-15)20-13(9)21/h2-3,6-7H,1,4-5H2,(H,20,21)(H2,17,18,19) |
| InChIKey | RIDNYHAIHPZKGW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one?
The IUPAC name of 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one (CID 171660626) is 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one.
What is the SMILES notation for 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one?
The canonical SMILES for 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one is Nc1ncc(Cl)c(-c2ccc3c(c2)C2(CCC2)NC3=O)n1.
What is the InChIKey of 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one?
The InChIKey is RIDNYHAIHPZKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4O/c16-11-7-18-14(17)19-12(11)8-2-3-9-10(6-8)15(4-1-5-15)20-13(9)21/h2-3,6-7H,1,4-5H2,(H,20,21)(H2,17,18,19).
What are the key properties of 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one?
5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one has a molecular weight of 300.75 g/mol, XLogP of 2.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-amino-5-chloropyrimidin-4-yl)spiro[2H-isoindole-3,1'-cyclobutane]-1-one is sourced from PubChem (CID 171660626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).