About 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole
5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole (PubChem CID 171661066) has the molecular formula C13H14Cl2N4S
and a molecular weight of 329.26 g/mol. Its IUPAC name is 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole |
| PubChem CID | 171661066 |
| Molecular Formula | C13H14Cl2N4S |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole |
| SMILES | CN1CCC(c2ncc(-c3nc(Cl)ncc3Cl)s2)CC1 |
| InChI | InChI=1S/C13H14Cl2N4S/c1-19-4-2-8(3-5-19)12-16-7-10(20-12)11-9(14)6-17-13(15)18-11/h6-8H,2-5H2,1H3 |
| InChIKey | RNFRJYDKVWONKM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole?
The IUPAC name of 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole (CID 171661066) is 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole.
What is the SMILES notation for 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole?
The canonical SMILES for 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole is CN1CCC(c2ncc(-c3nc(Cl)ncc3Cl)s2)CC1.
What is the InChIKey of 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole?
The InChIKey is RNFRJYDKVWONKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N4S/c1-19-4-2-8(3-5-19)12-16-7-10(20-12)11-9(14)6-17-13(15)18-11/h6-8H,2-5H2,1H3.
What are the key properties of 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole?
5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole has a molecular weight of 329.26 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dichloropyrimidin-4-yl)-2-(1-methylpiperidin-4-yl)-1,3-thiazole is sourced from PubChem (CID 171661066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).