C12H11N7 — CID 171661508
1-phenyl-N-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]methanimine (PubChem CID 171661508) has the molecular formula C12H11N7 and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-phenyl-N-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]methanimine.
| Compound Name | 1-phenyl-N-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]methanimine |
|---|---|
| PubChem CID | 171661508 |
| Molecular Formula | C12H11N7 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-phenyl-N-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]methanimine |
| SMILES | C(=Nc1n[nH]c(Cn2cncn2)n1)c1ccccc1 |
| InChI | InChI=1S/C12H11N7/c1-2-4-10(5-3-1)6-14-12-16-11(17-18-12)7-19-9-13-8-15-19/h1-6,8-9H,7H2,(H,16,17,18) |
| InChIKey | AMMQGCSDFQQCOQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|