C20H30F3NO2 — CID 171661730
tert-butyl N-[2-[4-(trifluoromethyl)phenyl]octyl]carbamate (PubChem CID 171661730) has the molecular formula C20H30F3NO2 and a molecular weight of 373.46 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(trifluoromethyl)phenyl]octyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(trifluoromethyl)phenyl]octyl]carbamate |
|---|---|
| PubChem CID | 171661730 |
| Molecular Formula | C20H30F3NO2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | tert-butyl N-[2-[4-(trifluoromethyl)phenyl]octyl]carbamate |
| SMILES | CCCCCCC(CNC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H30F3NO2/c1-5-6-7-8-9-16(14-24-18(25)26-19(2,3)4)15-10-12-17(13-11-15)20(21,22)23/h10-13,16H,5-9,14H2,1-4H3,(H,24,25) |
| InChIKey | VMEAFALBVKTZAR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|