C19H29F3N2O2 — CID 171661738
tert-butyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]octyl]carbamate (PubChem CID 171661738) has the molecular formula C19H29F3N2O2 and a molecular weight of 374.45 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]octyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]octyl]carbamate |
|---|---|
| PubChem CID | 171661738 |
| Molecular Formula | C19H29F3N2O2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]octyl]carbamate |
| SMILES | CCCCCCC(CNC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H29F3N2O2/c1-5-6-7-8-9-14(12-24-17(25)26-18(2,3)4)16-11-10-15(13-23-16)19(20,21)22/h10-11,13-14H,5-9,12H2,1-4H3,(H,24,25) |
| InChIKey | KKQZOTOVNHOBLC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|