About 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde
2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde (PubChem CID 171662158) has the molecular formula C16H10O6
and a molecular weight of 298.25 g/mol. Its IUPAC name is 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde |
| PubChem CID | 171662158 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde |
| SMILES | O=Cc1ccc2oc(C(=O)c3cc(O)c(O)c(O)c3)cc2c1 |
| InChI | InChI=1S/C16H10O6/c17-7-8-1-2-13-9(3-8)6-14(22-13)15(20)10-4-11(18)16(21)12(19)5-10/h1-7,18-19,21H |
| InChIKey | WCMIEQZBGLIBHO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde?
The IUPAC name of 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde (CID 171662158) is 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde.
What is the SMILES notation for 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde?
The canonical SMILES for 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde is O=Cc1ccc2oc(C(=O)c3cc(O)c(O)c(O)c3)cc2c1.
What is the InChIKey of 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde?
The InChIKey is WCMIEQZBGLIBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O6/c17-7-8-1-2-13-9(3-8)6-14(22-13)15(20)10-4-11(18)16(21)12(19)5-10/h1-7,18-19,21H.
What are the key properties of 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde?
2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde has a molecular weight of 298.25 g/mol, XLogP of 2.59, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-trihydroxybenzoyl)-1-benzofuran-5-carbaldehyde is sourced from PubChem (CID 171662158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).