C21H24N5O4S4+ — CID 171663930
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N-(1-methylcyclopropyl)-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,4-dioxo-4aH-thieno[2,3-d]pyrimidin-1-ium-6-sulfonamide (PubChem CID 171663930) has the molecular formula C21H24N5O4S4+ and a molecular weight of 538.72 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N-(1-methylcyclopropyl)-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,4-dioxo-4aH-thieno[2,3-d]pyrimidin-1-ium-6-sulfonamide.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N-(1-methylcyclopropyl)-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,4-dioxo-4aH-thieno[2,3-d]pyrimidin-1-ium-6-sulfonamide |
|---|---|
| PubChem CID | 171663930 |
| Molecular Formula | C21H24N5O4S4+ |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-N-(1-methylcyclopropyl)-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,4-dioxo-4aH-thieno[2,3-d]pyrimidin-1-ium-6-sulfonamide |
| SMILES | Cc1ncc(CN2C(=O)C3C=C(S(=O)(=O)NC4(C)CC4)SC3=[N+](Cc3sc(C)nc3C)C2=O)s1 |
| InChI | InChI=1S/C21H24N5O4S4/c1-11-16(32-13(3)23-11)10-26-19-15(7-17(33-19)34(29,30)24-21(4)5-6-21)18(27)25(20(26)28)9-14-8-22-12(2)31-14/h7-8,15,24H,5-6,9-10H2,1-4H3/q+1 |
| InChIKey | VGSPFDHKMCVVCS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|