About 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid
5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid (PubChem CID 171664148) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid |
| PubChem CID | 171664148 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid |
| SMILES | O=C1NCc2cc(-c3ccc(C4NNNC4C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C17H16N4O3/c22-16-13-6-5-11(7-12(13)8-18-16)9-1-3-10(4-2-9)14-15(17(23)24)20-21-19-14/h1-7,14-15,19-21H,8H2,(H,18,22)(H,23,24) |
| InChIKey | QWISLRFFGSAOPW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
The IUPAC name of 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid (CID 171664148) is 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid.
What is the SMILES notation for 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
The canonical SMILES for 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid is O=C1NCc2cc(-c3ccc(C4NNNC4C(=O)O)cc3)ccc21.
What is the InChIKey of 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
The InChIKey is QWISLRFFGSAOPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c22-16-13-6-5-11(7-12(13)8-18-16)9-1-3-10(4-2-9)14-15(17(23)24)20-21-19-14/h1-7,14-15,19-21H,8H2,(H,18,22)(H,23,24).
What are the key properties of 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid has a molecular weight of 324.34 g/mol, XLogP of 0.70, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1-oxo-2,3-dihydroisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid is sourced from PubChem (CID 171664148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).