About 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid
5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid (PubChem CID 171664172) has the molecular formula C20H22N4O3
and a molecular weight of 366.42 g/mol. Its IUPAC name is 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid |
| PubChem CID | 171664172 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid |
| SMILES | CN1C(=O)c2ccc(-c3ccc(C4NNNC4C(=O)O)cc3)cc2C1(C)C |
| InChI | InChI=1S/C20H22N4O3/c1-20(2)15-10-13(8-9-14(15)18(25)24(20)3)11-4-6-12(7-5-11)16-17(19(26)27)22-23-21-16/h4-10,16-17,21-23H,1-3H3,(H,26,27) |
| InChIKey | QMWHFOGCCWFGSI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
The IUPAC name of 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid (CID 171664172) is 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid.
What is the SMILES notation for 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
The canonical SMILES for 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid is CN1C(=O)c2ccc(-c3ccc(C4NNNC4C(=O)O)cc3)cc2C1(C)C.
What is the InChIKey of 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
The InChIKey is QMWHFOGCCWFGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3/c1-20(2)15-10-13(8-9-14(15)18(25)24(20)3)11-4-6-12(7-5-11)16-17(19(26)27)22-23-21-16/h4-10,16-17,21-23H,1-3H3,(H,26,27).
What are the key properties of 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid?
5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid has a molecular weight of 366.42 g/mol, XLogP of 1.78, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2,3,3-trimethyl-1-oxoisoindol-5-yl)phenyl]triazolidine-4-carboxylic acid is sourced from PubChem (CID 171664172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).