About N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide
N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide (PubChem CID 171664603) has the molecular formula C14H9F3N4O2S2
and a molecular weight of 386.38 g/mol. Its IUPAC name is N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide |
| PubChem CID | 171664603 |
| Molecular Formula | C14H9F3N4O2S2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ncc(C(F)(F)F)s2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C14H9F3N4O2S2/c1-7-2-3-9(12-11(7)8(4-18)5-19-12)21-25(22,23)13-20-6-10(24-13)14(15,16)17/h2-3,5-6,19,21H,1H3 |
| InChIKey | WKILGNZHIMEEML-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide?
The IUPAC name of N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide (CID 171664603) is N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide.
What is the SMILES notation for N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide?
The canonical SMILES for N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide is Cc1ccc(NS(=O)(=O)c2ncc(C(F)(F)F)s2)c2[nH]cc(C#N)c12.
What is the InChIKey of N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide?
The InChIKey is WKILGNZHIMEEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N4O2S2/c1-7-2-3-9(12-11(7)8(4-18)5-19-12)21-25(22,23)13-20-6-10(24-13)14(15,16)17/h2-3,5-6,19,21H,1H3.
What are the key properties of N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide?
N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide has a molecular weight of 386.38 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4-methyl-1H-indol-7-yl)-5-(trifluoromethyl)-1,3-thiazole-2-sulfonamide is sourced from PubChem (CID 171664603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).