About N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide
N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide (PubChem CID 171664611) has the molecular formula C13H7F3N4O2S2
and a molecular weight of 372.35 g/mol. Its IUPAC name is N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide |
| PubChem CID | 171664611 |
| Molecular Formula | C13H7F3N4O2S2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide |
| SMILES | N#Cc1c[nH]c2c(NS(=O)(=O)c3csc(C(F)(F)F)n3)cccc12 |
| InChI | InChI=1S/C13H7F3N4O2S2/c14-13(15,16)12-19-10(6-23-12)24(21,22)20-9-3-1-2-8-7(4-17)5-18-11(8)9/h1-3,5-6,18,20H |
| InChIKey | JMMABQBDZILPCY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide?
The IUPAC name of N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide (CID 171664611) is N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide.
What is the SMILES notation for N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide?
The canonical SMILES for N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide is N#Cc1c[nH]c2c(NS(=O)(=O)c3csc(C(F)(F)F)n3)cccc12.
What is the InChIKey of N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide?
The InChIKey is JMMABQBDZILPCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N4O2S2/c14-13(15,16)12-19-10(6-23-12)24(21,22)20-9-3-1-2-8-7(4-17)5-18-11(8)9/h1-3,5-6,18,20H.
What are the key properties of N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide?
N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide has a molecular weight of 372.35 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-1H-indol-7-yl)-2-(trifluoromethyl)-1,3-thiazole-4-sulfonamide is sourced from PubChem (CID 171664611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).