About N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide
N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide (PubChem CID 171664649) has the molecular formula C11H8ClN3O2S2
and a molecular weight of 313.79 g/mol. Its IUPAC name is N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide |
| PubChem CID | 171664649 |
| Molecular Formula | C11H8ClN3O2S2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc2c(Cl)c[nH]c12)c1nccs1 |
| InChI | InChI=1S/C11H8ClN3O2S2/c12-8-6-14-10-7(8)2-1-3-9(10)15-19(16,17)11-13-4-5-18-11/h1-6,14-15H |
| InChIKey | OUQZJLYFWKKANV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide?
The IUPAC name of N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide (CID 171664649) is N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide.
What is the SMILES notation for N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide?
The canonical SMILES for N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide is O=S(=O)(Nc1cccc2c(Cl)c[nH]c12)c1nccs1.
What is the InChIKey of N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide?
The InChIKey is OUQZJLYFWKKANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O2S2/c12-8-6-14-10-7(8)2-1-3-9(10)15-19(16,17)11-13-4-5-18-11/h1-6,14-15H.
What are the key properties of N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide?
N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide has a molecular weight of 313.79 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide is sourced from PubChem (CID 171664649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).