C8H3F5N2O — CID 171665702
2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carbonitrile (PubChem CID 171665702) has the molecular formula C8H3F5N2O and a molecular weight of 238.11 g/mol. Its IUPAC name is 2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171665702 |
| Molecular Formula | C8H3F5N2O |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)C(F)(F)F)cc[nH]c1=O |
| InChI | InChI=1S/C8H3F5N2O/c9-7(10,8(11,12)13)5-1-2-15-6(16)4(5)3-14/h1-2H,(H,15,16) |
| InChIKey | ZSLKUQJSWFOLKD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|