C20H29BrN4O3 — CID 171665879
ethyl 4-[1-(2-amino-5-bromobenzoyl)piperidin-4-yl]-1,4-diazepane-1-carboxylate (PubChem CID 171665879) has the molecular formula C20H29BrN4O3 and a molecular weight of 453.38 g/mol. Its IUPAC name is ethyl 4-[1-(2-amino-5-bromobenzoyl)piperidin-4-yl]-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-[1-(2-amino-5-bromobenzoyl)piperidin-4-yl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 171665879 |
| Molecular Formula | C20H29BrN4O3 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | ethyl 4-[1-(2-amino-5-bromobenzoyl)piperidin-4-yl]-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C2CCN(C(=O)c3cc(Br)ccc3N)CC2)CC1 |
| InChI | InChI=1S/C20H29BrN4O3/c1-2-28-20(27)25-9-3-8-23(12-13-25)16-6-10-24(11-7-16)19(26)17-14-15(21)4-5-18(17)22/h4-5,14,16H,2-3,6-13,22H2,1H3 |
| InChIKey | GYQADYNJUOHYHJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|