About 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride
1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride (PubChem CID 171667724) has the molecular formula C18H23ClN4O
and a molecular weight of 346.86 g/mol. Its IUPAC name is 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride |
| PubChem CID | 171667724 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride |
| SMILES | Cc1cccc(OCCCn2cncc2-c2cn(C)nc2C)c1.Cl |
| InChI | InChI=1S/C18H22N4O.ClH/c1-14-6-4-7-16(10-14)23-9-5-8-22-13-19-11-18(22)17-12-21(3)20-15(17)2;/h4,6-7,10-13H,5,8-9H2,1-3H3;1H |
| InChIKey | QGDSPKKBFAPKTR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride?
The IUPAC name of 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride (CID 171667724) is 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride.
What is the SMILES notation for 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride?
The canonical SMILES for 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride is Cc1cccc(OCCCn2cncc2-c2cn(C)nc2C)c1.Cl.
What is the InChIKey of 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride?
The InChIKey is QGDSPKKBFAPKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O.ClH/c1-14-6-4-7-16(10-14)23-9-5-8-22-13-19-11-18(22)17-12-21(3)20-15(17)2;/h4,6-7,10-13H,5,8-9H2,1-3H3;1H.
What are the key properties of 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride?
1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride has a molecular weight of 346.86 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4-[3-[3-(3-methylphenoxy)propyl]imidazol-4-yl]pyrazole;hydrochloride is sourced from PubChem (CID 171667724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).