C21H24N2O5 — CID 171668760
oxalic acid;N-(2-phenylphenyl)-2-pyrrolidin-1-ylpropanamide (PubChem CID 171668760) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is oxalic acid;N-(2-phenylphenyl)-2-pyrrolidin-1-ylpropanamide.
| Compound Name | oxalic acid;N-(2-phenylphenyl)-2-pyrrolidin-1-ylpropanamide |
|---|---|
| PubChem CID | 171668760 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | oxalic acid;N-(2-phenylphenyl)-2-pyrrolidin-1-ylpropanamide |
| SMILES | CC(C(=O)Nc1ccccc1-c1ccccc1)N1CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H22N2O.C2H2O4/c1-15(21-13-7-8-14-21)19(22)20-18-12-6-5-11-17(18)16-9-3-2-4-10-16;3-1(4)2(5)6/h2-6,9-12,15H,7-8,13-14H2,1H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | DCZAIHCTUUOLPZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|