About N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid
N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid (PubChem CID 171668876) has the molecular formula C18H33N3O5
and a molecular weight of 371.48 g/mol. Its IUPAC name is N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid.
Molecular Properties
| Compound Name | N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid |
| PubChem CID | 171668876 |
| Molecular Formula | C18H33N3O5 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid |
| SMILES | CCN(CC)C(=O)CN1CCC(N2CCCCC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H31N3O.C2H2O4/c1-3-18(4-2)16(20)14-17-12-8-15(9-13-17)19-10-6-5-7-11-19;3-1(4)2(5)6/h15H,3-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LUZNXZRZVKUAQE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid?
The IUPAC name of N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid (CID 171668876) is N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid.
What is the SMILES notation for N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid?
The canonical SMILES for N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid is CCN(CC)C(=O)CN1CCC(N2CCCCC2)CC1.O=C(O)C(=O)O.
What is the InChIKey of N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid?
The InChIKey is LUZNXZRZVKUAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O.C2H2O4/c1-3-18(4-2)16(20)14-17-12-8-15(9-13-17)19-10-6-5-7-11-19;3-1(4)2(5)6/h15H,3-14H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid?
N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid has a molecular weight of 371.48 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide;oxalic acid is sourced from PubChem (CID 171668876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).