C24H28IN3O2 — CID 171669005
2-[2-methyl-3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide iodide (PubChem CID 171669005) has the molecular formula C24H28IN3O2 and a molecular weight of 517.41 g/mol. Its IUPAC name is 2-[2-methyl-3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide iodide.
| Compound Name | 2-[2-methyl-3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide iodide |
|---|---|
| PubChem CID | 171669005 |
| Molecular Formula | C24H28IN3O2 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 2-[2-methyl-3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]indol-1-yl]-N-(oxolan-2-ylmethyl)acetamide iodide |
| SMILES | Cc1c(/C=C/c2cc[n+](C)cc2)c2ccccc2n1CC(=O)NCC1CCCO1.[I-] |
| InChI | InChI=1S/C24H27N3O2.HI/c1-18-21(10-9-19-11-13-26(2)14-12-19)22-7-3-4-8-23(22)27(18)17-24(28)25-16-20-6-5-15-29-20;/h3-4,7-14,20H,5-6,15-17H2,1-2H3;1H |
| InChIKey | MSKXBYNJKLMLIS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|