C33H47NO10 — CID 171669631
[(2R,4S,5R,6S,8R,13R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate (PubChem CID 171669631) has the molecular formula C33H47NO10 and a molecular weight of 617.74 g/mol. Its IUPAC name is [(2R,4S,5R,6S,8R,13R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate.
| Compound Name | [(2R,4S,5R,6S,8R,13R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 171669631 |
| Molecular Formula | C33H47NO10 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | [(2R,4S,5R,6S,8R,13R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate |
| SMILES | CCN1C[C@]2(COC)C(O)CC(OC)C34C1C(C(OC)[C@@H]32)[C@@]1(O)C[C@H](OC)[C@]2(O)C[C@@H]4C1C2OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H47NO10/c1-7-34-15-30(16-39-2)20(35)12-21(41-4)33-19-13-31(37)22(42-5)14-32(38,24(27(33)34)25(43-6)26(30)33)23(19)28(31)44-29(36)17-8-10-18(40-3)11-9-17/h8-11,19-28,35,37-38H,7,12-16H2,1-6H3/t19-,20?,21?,22+,23?,24?,25?,26-,27?,28?,30+,31-,32-,33?/m1/s1 |
| InChIKey | DHVYLCVNTWPXSI-PZQVQFBSSA-N |
| XLogP | 1.12 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |