C17H17BrN2O2 — CID 171669839
3-[(2-hydroxyanilino)methyl]-7-methyl-1H-quinolin-2-one;hydrobromide (PubChem CID 171669839) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 3-[(2-hydroxyanilino)methyl]-7-methyl-1H-quinolin-2-one;hydrobromide.
| Compound Name | 3-[(2-hydroxyanilino)methyl]-7-methyl-1H-quinolin-2-one;hydrobromide |
|---|---|
| PubChem CID | 171669839 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-[(2-hydroxyanilino)methyl]-7-methyl-1H-quinolin-2-one;hydrobromide |
| SMILES | Br.Cc1ccc2cc(CNc3ccccc3O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H16N2O2.BrH/c1-11-6-7-12-9-13(17(21)19-15(12)8-11)10-18-14-4-2-3-5-16(14)20;/h2-9,18,20H,10H2,1H3,(H,19,21);1H |
| InChIKey | WICUIPVJSTXTPF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|