C26H28FN3O11 — CID 171670409
3-(3-ethoxy-1,2-oxazol-5-yl)-1-[3-(2-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-5-yl]propan-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 171670409) has the molecular formula C26H28FN3O11 and a molecular weight of 577.52 g/mol. Its IUPAC name is 3-(3-ethoxy-1,2-oxazol-5-yl)-1-[3-(2-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-5-yl]propan-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 3-(3-ethoxy-1,2-oxazol-5-yl)-1-[3-(2-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-5-yl]propan-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 171670409 |
| Molecular Formula | C26H28FN3O11 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | 3-(3-ethoxy-1,2-oxazol-5-yl)-1-[3-(2-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-5-yl]propan-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCOc1cc(CCC(=O)N2CCc3onc(-c4ccccc4F)c3C2)on1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H20FN3O4.C6H8O7/c1-2-26-18-11-13(27-22-18)7-8-19(25)24-10-9-17-15(12-24)20(23-28-17)14-5-3-4-6-16(14)21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-6,11H,2,7-10,12H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | TTYUNPLQOAHRMF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 213.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |