C28H38N2O9 — CID 171670659
cis-(1R,2S)-N-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-2-[(3-methyl-1,2-oxazol-5-yl)methyl]cyclopentan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 171670659) has the molecular formula C28H38N2O9 and a molecular weight of 546.62 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-2-[(3-methyl-1,2-oxazol-5-yl)methyl]cyclopentan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | cis-(1R,2S)-N-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-2-[(3-methyl-1,2-oxazol-5-yl)methyl]cyclopentan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 171670659 |
| Molecular Formula | C28H38N2O9 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | cis-(1R,2S)-N-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-2-[(3-methyl-1,2-oxazol-5-yl)methyl]cyclopentan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCOc1cc2c(cc1CN[C@@H]1CCC[C@H]1Cc1cc(C)no1)CCC2.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H30N2O2.C6H8O7/c1-3-25-22-13-17-7-4-6-16(17)11-19(22)14-23-21-9-5-8-18(21)12-20-10-15(2)24-26-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h10-11,13,18,21,23H,3-9,12,14H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t18-,21+;/m0./s1 |
| InChIKey | NDDQDLQUCYDRDY-OZYANKIXSA-N |
| XLogP | 3.12 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |