C27H34FN3O9 — CID 171670888
(5R,6S)-5-[[3-[(dimethylamino)methyl]-4-hydroxyphenyl]methylamino]-6-(2-fluorophenyl)piperidin-2-one;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 171670888) has the molecular formula C27H34FN3O9 and a molecular weight of 563.58 g/mol. Its IUPAC name is (5R,6S)-5-[[3-[(dimethylamino)methyl]-4-hydroxyphenyl]methylamino]-6-(2-fluorophenyl)piperidin-2-one;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (5R,6S)-5-[[3-[(dimethylamino)methyl]-4-hydroxyphenyl]methylamino]-6-(2-fluorophenyl)piperidin-2-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 171670888 |
| Molecular Formula | C27H34FN3O9 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (5R,6S)-5-[[3-[(dimethylamino)methyl]-4-hydroxyphenyl]methylamino]-6-(2-fluorophenyl)piperidin-2-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)Cc1cc(CN[C@@H]2CCC(=O)NC2c2ccccc2F)ccc1O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H26FN3O2.C6H8O7/c1-25(2)13-15-11-14(7-9-19(15)26)12-23-18-8-10-20(27)24-21(18)16-5-3-4-6-17(16)22;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-7,9,11,18,21,23,26H,8,10,12-13H2,1-2H3,(H,24,27);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t18-,21?;/m1./s1 |
| InChIKey | BTMLWYJQKOIEHC-APUUZKBCSA-N |
| XLogP | 1.45 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|