C28H35N3O8 — CID 171670989
2-hydroxypropane-1,2,3-tricarboxylic acid;3-propan-2-yloxy-N-(pyridin-2-ylmethyl)-N-(quinolin-6-ylmethyl)propan-1-amine (PubChem CID 171670989) has the molecular formula C28H35N3O8 and a molecular weight of 541.60 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;3-propan-2-yloxy-N-(pyridin-2-ylmethyl)-N-(quinolin-6-ylmethyl)propan-1-amine.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;3-propan-2-yloxy-N-(pyridin-2-ylmethyl)-N-(quinolin-6-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 171670989 |
| Molecular Formula | C28H35N3O8 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;3-propan-2-yloxy-N-(pyridin-2-ylmethyl)-N-(quinolin-6-ylmethyl)propan-1-amine |
| SMILES | CC(C)OCCCN(Cc1ccc2ncccc2c1)Cc1ccccn1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27N3O.C6H8O7/c1-18(2)26-14-6-13-25(17-21-8-3-4-11-23-21)16-19-9-10-22-20(15-19)7-5-12-24-22;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-5,7-12,15,18H,6,13-14,16-17H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | PLYLLQUCRBDOLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 170.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|