C32H45N3O9 — CID 171671981
2-hydroxypropane-1,2,3-tricarboxylic acid;N-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-2,2,6,6-tetramethyl-N-(pyridin-2-ylmethyl)piperidin-4-amine (PubChem CID 171671981) has the molecular formula C32H45N3O9 and a molecular weight of 615.72 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;N-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-2,2,6,6-tetramethyl-N-(pyridin-2-ylmethyl)piperidin-4-amine.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-2,2,6,6-tetramethyl-N-(pyridin-2-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 171671981 |
| Molecular Formula | C32H45N3O9 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-[(3-methoxy-2-prop-2-enoxyphenyl)methyl]-2,2,6,6-tetramethyl-N-(pyridin-2-ylmethyl)piperidin-4-amine |
| SMILES | C=CCOc1c(CN(Cc2ccccn2)C2CC(C)(C)NC(C)(C)C2)cccc1OC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H37N3O2.C6H8O7/c1-7-15-31-24-20(11-10-13-23(24)30-6)18-29(19-21-12-8-9-14-27-21)22-16-25(2,3)28-26(4,5)17-22;7-3(8)1-6(13,5(11)12)2-4(9)10/h7-14,22,28H,1,15-19H2,2-6H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | JNYPAPIMBQXSJY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 178.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|