C19H27F3N2O4S — CID 171672589
4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 171672589) has the molecular formula C19H27F3N2O4S and a molecular weight of 436.50 g/mol. Its IUPAC name is 4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171672589 |
| Molecular Formula | C19H27F3N2O4S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2CCC3OCCCC3(COCC3CC3)C2)n1 |
| InChI | InChI=1S/C17H26N2O2S.C2HF3O2/c1-5-17(13-20-11-14-2-3-14)12-19(7-4-15(17)21-8-1)10-16-18-6-9-22-16;3-2(4,5)1(6)7/h6,9,14-15H,1-5,7-8,10-13H2;(H,6,7) |
| InChIKey | FGVLWISLIUHFOR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |