C20H23F3N4O6S — CID 171672962
5-ethyl-6,6-dioxo-N-(oxolan-2-ylmethyl)-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171672962) has the molecular formula C20H23F3N4O6S and a molecular weight of 504.49 g/mol. Its IUPAC name is 5-ethyl-6,6-dioxo-N-(oxolan-2-ylmethyl)-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-ethyl-6,6-dioxo-N-(oxolan-2-ylmethyl)-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171672962 |
| Molecular Formula | C20H23F3N4O6S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 5-ethyl-6,6-dioxo-N-(oxolan-2-ylmethyl)-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1Cc2c(C(=O)NCC3CCCO3)ncn2-c2ccccc2S1(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N4O4S.C2HF3O2/c1-2-21-11-15-17(18(23)19-10-13-6-5-9-26-13)20-12-22(15)14-7-3-4-8-16(14)27(21,24)25;3-2(4,5)1(6)7/h3-4,7-8,12-13H,2,5-6,9-11H2,1H3,(H,19,23);(H,6,7) |
| InChIKey | RPAXAQNAQMGIPV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |