C16H21F3N2O5S — CID 171673058
(1S,11S)-10,14-dimethyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 171673058) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is (1S,11S)-10,14-dimethyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,11S)-10,14-dimethyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171673058 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (1S,11S)-10,14-dimethyl-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene 9,9-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC[C@@H]2Oc3ccccc3S(=O)(=O)N(C)[C@H]2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N2O3S.C2HF3O2/c1-15-9-7-11-12(8-10-15)19-13-5-3-4-6-14(13)20(17,18)16(11)2;3-2(4,5)1(6)7/h3-6,11-12H,7-10H2,1-2H3;(H,6,7)/t11-,12-;/m0./s1 |
| InChIKey | LCGZSZKSVLYGKU-FXMYHANSSA-N |
| XLogP | 1.80 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |