C21H26F2N2O2 — CID 171673442
2-(2,6-difluorophenyl)-1-[5-(3,3-dimethylcyclobutanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone (PubChem CID 171673442) has the molecular formula C21H26F2N2O2 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-[5-(3,3-dimethylcyclobutanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone.
| Compound Name | 2-(2,6-difluorophenyl)-1-[5-(3,3-dimethylcyclobutanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 171673442 |
| Molecular Formula | C21H26F2N2O2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-[5-(3,3-dimethylcyclobutanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone |
| SMILES | CC1(C)CC(C(=O)N2CC3CN(C(=O)Cc4c(F)cccc4F)CC3C2)C1 |
| InChI | InChI=1S/C21H26F2N2O2/c1-21(2)7-13(8-21)20(27)25-11-14-9-24(10-15(14)12-25)19(26)6-16-17(22)4-3-5-18(16)23/h3-5,13-15H,6-12H2,1-2H3 |
| InChIKey | CZJBKZMWEHUNDZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |