C21H23FN4O3S — CID 171674028
5-[5-(5-ethyl-2-methoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-2-fluoroaniline (PubChem CID 171674028) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-[5-(5-ethyl-2-methoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-2-fluoroaniline.
| Compound Name | 5-[5-(5-ethyl-2-methoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-2-fluoroaniline |
|---|---|
| PubChem CID | 171674028 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 5-[5-(5-ethyl-2-methoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-2-fluoroaniline |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)N2CCc3[nH]nc(-c4ccc(F)c(N)c4)c3C2)c1 |
| InChI | InChI=1S/C21H23FN4O3S/c1-3-13-4-7-19(29-2)20(10-13)30(27,28)26-9-8-18-15(12-26)21(25-24-18)14-5-6-16(22)17(23)11-14/h4-7,10-11H,3,8-9,12,23H2,1-2H3,(H,24,25) |
| InChIKey | DJWGGFMWIDLDQV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|